C25H31F3NO4P — CID 15428268
9-(5-diethoxyphosphorylpentyl)-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 15428268) has the molecular formula C25H31F3NO4P and a molecular weight of 497.49 g/mol. Its IUPAC name is 9-(5-diethoxyphosphorylpentyl)-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-(5-diethoxyphosphorylpentyl)-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 15428268 |
| Molecular Formula | C25H31F3NO4P |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 9-(5-diethoxyphosphorylpentyl)-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | CCOP(=O)(CCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)OCC |
| InChI | InChI=1S/C25H31F3NO4P/c1-3-32-34(31,33-4-2)17-11-5-10-16-24(23(30)29-18-25(26,27)28)21-14-8-6-12-19(21)20-13-7-9-15-22(20)24/h6-9,12-15H,3-5,10-11,16-18H2,1-2H3,(H,29,30) |
| InChIKey | ANBYRKNMWHWZJG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|