C32H47N2O5P — CID 10231635
9-(4-dibutoxyphosphorylbutyl)-N-(2-morpholin-4-ylethyl)fluorene-9-carboxamide (PubChem CID 10231635) has the molecular formula C32H47N2O5P and a molecular weight of 570.71 g/mol. Its IUPAC name is 9-(4-dibutoxyphosphorylbutyl)-N-(2-morpholin-4-ylethyl)fluorene-9-carboxamide.
| Compound Name | 9-(4-dibutoxyphosphorylbutyl)-N-(2-morpholin-4-ylethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 10231635 |
| Molecular Formula | C32H47N2O5P |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | 9-(4-dibutoxyphosphorylbutyl)-N-(2-morpholin-4-ylethyl)fluorene-9-carboxamide |
| SMILES | CCCCOP(=O)(CCCCC1(C(=O)NCCN2CCOCC2)c2ccccc2-c2ccccc21)OCCCC |
| InChI | InChI=1S/C32H47N2O5P/c1-3-5-22-38-40(36,39-23-6-4-2)26-12-11-17-32(31(35)33-18-19-34-20-24-37-25-21-34)29-15-9-7-13-27(29)28-14-8-10-16-30(28)32/h7-10,13-16H,3-6,11-12,17-26H2,1-2H3,(H,33,35) |
| InChIKey | YTYFLZZSJZICPU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|