C30H38F3N3O2 — CID 54156865
9-[4-[4-(pentanoylamino)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 54156865) has the molecular formula C30H38F3N3O2 and a molecular weight of 529.65 g/mol. Its IUPAC name is 9-[4-[4-(pentanoylamino)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-(pentanoylamino)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 54156865 |
| Molecular Formula | C30H38F3N3O2 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | 9-[4-[4-(pentanoylamino)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | CCCCC(=O)NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C30H38F3N3O2/c1-2-3-14-27(37)35-22-15-19-36(20-16-22)18-9-8-17-29(28(38)34-21-30(31,32)33)25-12-6-4-10-23(25)24-11-5-7-13-26(24)29/h4-7,10-13,22H,2-3,8-9,14-21H2,1H3,(H,34,38)(H,35,37) |
| InChIKey | OLRSNGBWDKWCJY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|