C34H44N3O2P3 — CID 147630946
9-[4-[4-(3-phenylpropanoylamino)piperidin-1-yl]butyl]-N-[2,2,2-tris(phosphanyl)ethyl]fluorene-9-carboxamide (PubChem CID 147630946) has the molecular formula C34H44N3O2P3 and a molecular weight of 619.67 g/mol. Its IUPAC name is 9-[4-[4-(3-phenylpropanoylamino)piperidin-1-yl]butyl]-N-[2,2,2-tris(phosphanyl)ethyl]fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-(3-phenylpropanoylamino)piperidin-1-yl]butyl]-N-[2,2,2-tris(phosphanyl)ethyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 147630946 |
| Molecular Formula | C34H44N3O2P3 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | 9-[4-[4-(3-phenylpropanoylamino)piperidin-1-yl]butyl]-N-[2,2,2-tris(phosphanyl)ethyl]fluorene-9-carboxamide |
| SMILES | O=C(CCc1ccccc1)NC1CCN(CCCCC2(C(=O)NCC(P)(P)P)c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C34H44N3O2P3/c38-31(17-16-25-10-2-1-3-11-25)36-26-18-22-37(23-19-26)21-9-8-20-33(32(39)35-24-34(40,41)42)29-14-6-4-12-27(29)28-13-5-7-15-30(28)33/h1-7,10-15,26H,8-9,16-24,40-42H2,(H,35,39)(H,36,38) |
| InChIKey | GFRXCZSPNKBQBI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|