C39H36ClF6N3O2 — CID 19705176
9-[4-[4-[[5-chloro-2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 19705176) has the molecular formula C39H36ClF6N3O2 and a molecular weight of 728.18 g/mol. Its IUPAC name is 9-[4-[4-[[5-chloro-2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[[5-chloro-2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 19705176 |
| Molecular Formula | C39H36ClF6N3O2 |
| Molecular Weight | 728.18 g/mol |
| Exact Mass | 727.24 |
| IUPAC Name | 9-[4-[4-[[5-chloro-2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)c1cc(Cl)ccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C39H36ClF6N3O2/c40-27-15-16-29(25-11-13-26(14-12-25)39(44,45)46)32(23-27)35(50)48-28-17-21-49(22-18-28)20-6-5-19-37(36(51)47-24-38(41,42)43)33-9-3-1-7-30(33)31-8-2-4-10-34(31)37/h1-4,7-16,23,28H,5-6,17-22,24H2,(H,47,51)(H,48,50) |
| InChIKey | KVEAYSWJJNTBPL-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.18 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|