C33H36F3N3O2 — CID 54147603
9-[4-[4-[(3-methylbenzoyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 54147603) has the molecular formula C33H36F3N3O2 and a molecular weight of 563.66 g/mol. Its IUPAC name is 9-[4-[4-[(3-methylbenzoyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[(3-methylbenzoyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 54147603 |
| Molecular Formula | C33H36F3N3O2 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | 9-[4-[4-[(3-methylbenzoyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | Cc1cccc(C(=O)NC2CCN(CCCCC3(C(=O)NCC(F)(F)F)c4ccccc4-c4ccccc43)CC2)c1 |
| InChI | InChI=1S/C33H36F3N3O2/c1-23-9-8-10-24(21-23)30(40)38-25-15-19-39(20-16-25)18-7-6-17-32(31(41)37-22-33(34,35)36)28-13-4-2-11-26(28)27-12-3-5-14-29(27)32/h2-5,8-14,21,25H,6-7,15-20,22H2,1H3,(H,37,41)(H,38,40) |
| InChIKey | OFMPCJXZJGSMDZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|