C38H42F3N3O2 — CID 19705166
9-[4-[4-[(6-phenylcyclohexene-1-carbonyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 19705166) has the molecular formula C38H42F3N3O2 and a molecular weight of 629.77 g/mol. Its IUPAC name is 9-[4-[4-[(6-phenylcyclohexene-1-carbonyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[(6-phenylcyclohexene-1-carbonyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 19705166 |
| Molecular Formula | C38H42F3N3O2 |
| Molecular Weight | 629.77 g/mol |
| Exact Mass | 629.32 |
| IUPAC Name | 9-[4-[4-[(6-phenylcyclohexene-1-carbonyl)amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)C1=CCCCC1c1ccccc1 |
| InChI | InChI=1S/C38H42F3N3O2/c39-38(40,41)26-42-36(46)37(33-18-8-6-15-30(33)31-16-7-9-19-34(31)37)22-10-11-23-44-24-20-28(21-25-44)43-35(45)32-17-5-4-14-29(32)27-12-2-1-3-13-27/h1-3,6-9,12-13,15-19,28-29H,4-5,10-11,14,20-26H2,(H,42,46)(H,43,45) |
| InChIKey | GMCJVGNTMSIXAD-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.77 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|