C36H34F3N3O3 — CID 67718432
9-[4-[3-[(2-phenoxybenzoyl)amino]azetidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 67718432) has the molecular formula C36H34F3N3O3 and a molecular weight of 613.68 g/mol. Its IUPAC name is 9-[4-[3-[(2-phenoxybenzoyl)amino]azetidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[3-[(2-phenoxybenzoyl)amino]azetidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 67718432 |
| Molecular Formula | C36H34F3N3O3 |
| Molecular Weight | 613.68 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | 9-[4-[3-[(2-phenoxybenzoyl)amino]azetidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NC1CN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)C1)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C36H34F3N3O3/c37-36(38,39)24-40-34(44)35(30-17-7-4-14-27(30)28-15-5-8-18-31(28)35)20-10-11-21-42-22-25(23-42)41-33(43)29-16-6-9-19-32(29)45-26-12-2-1-3-13-26/h1-9,12-19,25H,10-11,20-24H2,(H,40,44)(H,41,43) |
| InChIKey | BVGHRLQMXXQODI-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.68 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|