C37H34F5N3O3 — CID 18944317
3,6-difluoro-9-[4-[3-[(2-phenoxybenzoyl)amino]pyrrolidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18944317) has the molecular formula C37H34F5N3O3 and a molecular weight of 663.69 g/mol. Its IUPAC name is 3,6-difluoro-9-[4-[3-[(2-phenoxybenzoyl)amino]pyrrolidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 3,6-difluoro-9-[4-[3-[(2-phenoxybenzoyl)amino]pyrrolidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18944317 |
| Molecular Formula | C37H34F5N3O3 |
| Molecular Weight | 663.69 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | 3,6-difluoro-9-[4-[3-[(2-phenoxybenzoyl)amino]pyrrolidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccc(F)cc3-c3cc(F)ccc32)C1)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C37H34F5N3O3/c38-24-12-14-31-29(20-24)30-21-25(39)13-15-32(30)36(31,35(47)43-23-37(40,41)42)17-6-7-18-45-19-16-26(22-45)44-34(46)28-10-4-5-11-33(28)48-27-8-2-1-3-9-27/h1-5,8-15,20-21,26H,6-7,16-19,22-23H2,(H,43,47)(H,44,46) |
| InChIKey | ZSZSNDLIVFWQSX-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.69 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|