C33H36F6N4O2S — CID 163514406
N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)-1,2-dihydrofluoren-9-yl]butyl]piperidin-4-yl]-2-(2,2,2-trifluoroethylsulfanyl)pyridine-3-carboxamide (PubChem CID 163514406) has the molecular formula C33H36F6N4O2S and a molecular weight of 666.73 g/mol. Its IUPAC name is N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)-1,2-dihydrofluoren-9-yl]butyl]piperidin-4-yl]-2-(2,2,2-trifluoroethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)-1,2-dihydrofluoren-9-yl]butyl]piperidin-4-yl]-2-(2,2,2-trifluoroethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163514406 |
| Molecular Formula | C33H36F6N4O2S |
| Molecular Weight | 666.73 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)-1,2-dihydrofluoren-9-yl]butyl]piperidin-4-yl]-2-(2,2,2-trifluoroethylsulfanyl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)C3=C(C=CCC3)c3ccccc32)CC1)c1cccnc1SCC(F)(F)F |
| InChI | InChI=1S/C33H36F6N4O2S/c34-32(35,36)20-41-30(45)31(26-11-3-1-8-23(26)24-9-2-4-12-27(24)31)15-5-6-17-43-18-13-22(14-19-43)42-28(44)25-10-7-16-40-29(25)46-21-33(37,38)39/h1-3,7-11,16,22H,4-6,12-15,17-21H2,(H,41,45)(H,42,44) |
| InChIKey | DFLRMLFDCAVUCO-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.73 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|