C21H19BrF5NO — CID 22636275
9-(4-bromobutyl)-N-(2,2,3,3,3-pentafluoropropyl)fluorene-9-carboxamide (PubChem CID 22636275) has the molecular formula C21H19BrF5NO and a molecular weight of 476.28 g/mol. Its IUPAC name is 9-(4-bromobutyl)-N-(2,2,3,3,3-pentafluoropropyl)fluorene-9-carboxamide.
| Compound Name | 9-(4-bromobutyl)-N-(2,2,3,3,3-pentafluoropropyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22636275 |
| Molecular Formula | C21H19BrF5NO |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 9-(4-bromobutyl)-N-(2,2,3,3,3-pentafluoropropyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)(F)F)C1(CCCCBr)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H19BrF5NO/c22-12-6-5-11-19(18(29)28-13-20(23,24)21(25,26)27)16-9-3-1-7-14(16)15-8-2-4-10-17(15)19/h1-4,7-10H,5-6,11-13H2,(H,28,29) |
| InChIKey | IPBBTWKAMYQRBC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|