C31H39F3NO6P — CID 22891375
9-[5-[bis(oxolan-2-ylmethoxy)phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22891375) has the molecular formula C31H39F3NO6P and a molecular weight of 609.62 g/mol. Its IUPAC name is 9-[5-[bis(oxolan-2-ylmethoxy)phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[5-[bis(oxolan-2-ylmethoxy)phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891375 |
| Molecular Formula | C31H39F3NO6P |
| Molecular Weight | 609.62 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | 9-[5-[bis(oxolan-2-ylmethoxy)phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCCP(=O)(OCC2CCCO2)OCC2CCCO2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H39F3NO6P/c32-31(33,34)22-35-29(36)30(27-14-4-2-12-25(27)26-13-3-5-15-28(26)30)16-6-1-7-19-42(37,40-20-23-10-8-17-38-23)41-21-24-11-9-18-39-24/h2-5,12-15,23-24H,1,6-11,16-22H2,(H,35,36) |
| InChIKey | MRLIOAHGEKCPFR-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.62 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|