C30H30F3N3O3 — CID 22891220
9-[4-(3-benzamidopropanoylamino)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22891220) has the molecular formula C30H30F3N3O3 and a molecular weight of 537.58 g/mol. Its IUPAC name is 9-[4-(3-benzamidopropanoylamino)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-(3-benzamidopropanoylamino)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891220 |
| Molecular Formula | C30H30F3N3O3 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 9-[4-(3-benzamidopropanoylamino)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccccc1)NCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H30F3N3O3/c31-30(32,33)20-36-28(39)29(24-14-6-4-12-22(24)23-13-5-7-15-25(23)29)17-8-9-18-34-26(37)16-19-35-27(38)21-10-2-1-3-11-21/h1-7,10-15H,8-9,16-20H2,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | WMRXQFZJYHAAIY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|