C34H29F3N4O2 — CID 18409344
9-[4-(5-benzamidobenzimidazol-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18409344) has the molecular formula C34H29F3N4O2 and a molecular weight of 582.63 g/mol. Its IUPAC name is 9-[4-(5-benzamidobenzimidazol-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-(5-benzamidobenzimidazol-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18409344 |
| Molecular Formula | C34H29F3N4O2 |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | 9-[4-(5-benzamidobenzimidazol-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)ncn2CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C34H29F3N4O2/c35-34(36,37)21-38-32(43)33(27-14-6-4-12-25(27)26-13-5-7-15-28(26)33)18-8-9-19-41-22-39-29-20-24(16-17-30(29)41)40-31(42)23-10-2-1-3-11-23/h1-7,10-17,20,22H,8-9,18-19,21H2,(H,38,43)(H,40,42) |
| InChIKey | KYEHUDKMUDAHEU-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|