C40H32ClF3N4O2 — CID 18409186
9-[4-[4-[[2-(3-chlorophenyl)benzoyl]amino]benzimidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18409186) has the molecular formula C40H32ClF3N4O2 and a molecular weight of 693.17 g/mol. Its IUPAC name is 9-[4-[4-[[2-(3-chlorophenyl)benzoyl]amino]benzimidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[[2-(3-chlorophenyl)benzoyl]amino]benzimidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18409186 |
| Molecular Formula | C40H32ClF3N4O2 |
| Molecular Weight | 693.17 g/mol |
| Exact Mass | 692.22 |
| IUPAC Name | 9-[4-[4-[[2-(3-chlorophenyl)benzoyl]amino]benzimidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(Nc1cccc2c1ncn2CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)c1ccccc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C40H32ClF3N4O2/c41-27-12-9-11-26(23-27)28-13-1-2-16-31(28)37(49)47-34-19-10-20-35-36(34)46-25-48(35)22-8-7-21-39(38(50)45-24-40(42,43)44)32-17-5-3-14-29(32)30-15-4-6-18-33(30)39/h1-6,9-20,23,25H,7-8,21-22,24H2,(H,45,50)(H,47,49) |
| InChIKey | OVMYRKGTRFMTDH-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.17 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|