C36H32Cl2F3N5O2 — CID 172704361
9-[3-[[6-[(2-pyridin-2-ylbenzoyl)amino]-3-pyridinyl]amino]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;dihydrochloride (PubChem CID 172704361) has the molecular formula C36H32Cl2F3N5O2 and a molecular weight of 694.59 g/mol. Its IUPAC name is 9-[3-[[6-[(2-pyridin-2-ylbenzoyl)amino]-3-pyridinyl]amino]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;dihydrochloride.
| Compound Name | 9-[3-[[6-[(2-pyridin-2-ylbenzoyl)amino]-3-pyridinyl]amino]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 172704361 |
| Molecular Formula | C36H32Cl2F3N5O2 |
| Molecular Weight | 694.59 g/mol |
| Exact Mass | 693.19 |
| IUPAC Name | 9-[3-[[6-[(2-pyridin-2-ylbenzoyl)amino]-3-pyridinyl]amino]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc(NCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)cn1)c1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C36H30F3N5O2.2ClH/c37-36(38,39)23-43-34(46)35(29-14-5-3-10-25(29)26-11-4-6-15-30(26)35)19-9-21-40-24-17-18-32(42-22-24)44-33(45)28-13-2-1-12-27(28)31-16-7-8-20-41-31;;/h1-8,10-18,20,22,40H,9,19,21,23H2,(H,43,46)(H,42,44,45);2*1H |
| InChIKey | DJQHXSUPQOPSGE-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.59 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|