C32H31F3N4O2S — CID 22891577
N-benzyl-2-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentylsulfanyl]-1H-imidazole-5-carboxamide (PubChem CID 22891577) has the molecular formula C32H31F3N4O2S and a molecular weight of 592.69 g/mol. Its IUPAC name is N-benzyl-2-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentylsulfanyl]-1H-imidazole-5-carboxamide.
| Compound Name | N-benzyl-2-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentylsulfanyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 22891577 |
| Molecular Formula | C32H31F3N4O2S |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | N-benzyl-2-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentylsulfanyl]-1H-imidazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cnc(SCCCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)[nH]1 |
| InChI | InChI=1S/C32H31F3N4O2S/c33-32(34,35)21-38-29(41)31(25-15-7-5-13-23(25)24-14-6-8-16-26(24)31)17-9-2-10-18-42-30-37-20-27(39-30)28(40)36-19-22-11-3-1-4-12-22/h1,3-8,11-16,20H,2,9-10,17-19,21H2,(H,36,40)(H,37,39)(H,38,41) |
| InChIKey | WUBRVMNFMWTTFK-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|