C29H31N3OS — CID 22891311
9-[5-(1H-benzimidazol-2-ylsulfanyl)pentyl]-N-propylfluorene-9-carboxamide (PubChem CID 22891311) has the molecular formula C29H31N3OS and a molecular weight of 469.65 g/mol. Its IUPAC name is 9-[5-(1H-benzimidazol-2-ylsulfanyl)pentyl]-N-propylfluorene-9-carboxamide.
| Compound Name | 9-[5-(1H-benzimidazol-2-ylsulfanyl)pentyl]-N-propylfluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891311 |
| Molecular Formula | C29H31N3OS |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 9-[5-(1H-benzimidazol-2-ylsulfanyl)pentyl]-N-propylfluorene-9-carboxamide |
| SMILES | CCCNC(=O)C1(CCCCCSc2nc3ccccc3[nH]2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H31N3OS/c1-2-19-30-27(33)29(23-14-6-4-12-21(23)22-13-5-7-15-24(22)29)18-10-3-11-20-34-28-31-25-16-8-9-17-26(25)32-28/h4-9,12-17H,2-3,10-11,18-20H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | HYJFEHLIMPYCKH-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|