C31H33N3O2S — CID 22891313
9-[5-(1H-imidazol-2-ylsulfanyl)pentyl]-N-[2-(4-methoxyphenyl)ethyl]fluorene-9-carboxamide (PubChem CID 22891313) has the molecular formula C31H33N3O2S and a molecular weight of 511.69 g/mol. Its IUPAC name is 9-[5-(1H-imidazol-2-ylsulfanyl)pentyl]-N-[2-(4-methoxyphenyl)ethyl]fluorene-9-carboxamide.
| Compound Name | 9-[5-(1H-imidazol-2-ylsulfanyl)pentyl]-N-[2-(4-methoxyphenyl)ethyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891313 |
| Molecular Formula | C31H33N3O2S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 9-[5-(1H-imidazol-2-ylsulfanyl)pentyl]-N-[2-(4-methoxyphenyl)ethyl]fluorene-9-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2(CCCCCSc3ncc[nH]3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C31H33N3O2S/c1-36-24-15-13-23(14-16-24)17-19-32-29(35)31(18-7-2-8-22-37-30-33-20-21-34-30)27-11-5-3-9-25(27)26-10-4-6-12-28(26)31/h3-6,9-16,20-21H,2,7-8,17-19,22H2,1H3,(H,32,35)(H,33,34) |
| InChIKey | JSVBUYYLXNUKSJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|