C30H32N4O2S — CID 22891492
N-[2-(4-methoxyphenyl)ethyl]-9-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]butyl]fluorene-9-carboxamide (PubChem CID 22891492) has the molecular formula C30H32N4O2S and a molecular weight of 512.68 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-9-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]butyl]fluorene-9-carboxamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-9-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]butyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891492 |
| Molecular Formula | C30H32N4O2S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-9-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]butyl]fluorene-9-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2(CCCCSc3nncn3C)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C30H32N4O2S/c1-34-21-32-33-29(34)37-20-8-7-18-30(28(35)31-19-17-22-13-15-23(36-2)16-14-22)26-11-5-3-9-24(26)25-10-4-6-12-27(25)30/h3-6,9-16,21H,7-8,17-20H2,1-2H3,(H,31,35) |
| InChIKey | GUTXXLFZRUISJH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|