C38H39N3O3S — CID 163987535
9-[5-[(4-hydroxy-6-phenyl-1,4-dihydropyrimidin-2-yl)sulfanyl]pentyl]-N-[2-(4-methoxyphenyl)ethyl]fluorene-9-carboxamide (PubChem CID 163987535) has the molecular formula C38H39N3O3S and a molecular weight of 617.82 g/mol. Its IUPAC name is 9-[5-[(4-hydroxy-6-phenyl-1,4-dihydropyrimidin-2-yl)sulfanyl]pentyl]-N-[2-(4-methoxyphenyl)ethyl]fluorene-9-carboxamide.
| Compound Name | 9-[5-[(4-hydroxy-6-phenyl-1,4-dihydropyrimidin-2-yl)sulfanyl]pentyl]-N-[2-(4-methoxyphenyl)ethyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 163987535 |
| Molecular Formula | C38H39N3O3S |
| Molecular Weight | 617.82 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | 9-[5-[(4-hydroxy-6-phenyl-1,4-dihydropyrimidin-2-yl)sulfanyl]pentyl]-N-[2-(4-methoxyphenyl)ethyl]fluorene-9-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2(CCCCCSC3=NC(O)C=C(c4ccccc4)N3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C38H39N3O3S/c1-44-29-20-18-27(19-21-29)22-24-39-36(43)38(32-16-8-6-14-30(32)31-15-7-9-17-33(31)38)23-10-3-11-25-45-37-40-34(26-35(42)41-37)28-12-4-2-5-13-28/h2,4-9,12-21,26,35,42H,3,10-11,22-25H2,1H3,(H,39,43)(H,40,41) |
| InChIKey | TXRABLOGNVFUKY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.82 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|