C37H37F3N4O3S — CID 162576846
9-[5-[[4-(5-methoxycyclohexa-1,3-dien-1-yl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 162576846) has the molecular formula C37H37F3N4O3S and a molecular weight of 674.79 g/mol. Its IUPAC name is 9-[5-[[4-(5-methoxycyclohexa-1,3-dien-1-yl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[5-[[4-(5-methoxycyclohexa-1,3-dien-1-yl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 162576846 |
| Molecular Formula | C37H37F3N4O3S |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.25 |
| IUPAC Name | 9-[5-[[4-(5-methoxycyclohexa-1,3-dien-1-yl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | COc1ccc(-c2nnc(SCCCCCC3(C(=O)NCC(F)(F)F)c4ccccc4-c4ccccc43)n2C2=CC=CC(OC)C2)cc1 |
| InChI | InChI=1S/C37H37F3N4O3S/c1-46-27-19-17-25(18-20-27)33-42-43-35(44(33)26-11-10-12-28(23-26)47-2)48-22-9-3-8-21-36(34(45)41-24-37(38,39)40)31-15-6-4-13-29(31)30-14-5-7-16-32(30)36/h4-7,10-20,28H,3,8-9,21-24H2,1-2H3,(H,41,45) |
| InChIKey | RXTCAQRUKRMMES-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|