C33H29F4N5OS2 — CID 22891323
9-[5-[[4-(3-fluorophenyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]sulfanyl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22891323) has the molecular formula C33H29F4N5OS2 and a molecular weight of 651.76 g/mol. Its IUPAC name is 9-[5-[[4-(3-fluorophenyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]sulfanyl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[5-[[4-(3-fluorophenyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]sulfanyl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891323 |
| Molecular Formula | C33H29F4N5OS2 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.17 |
| IUPAC Name | 9-[5-[[4-(3-fluorophenyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]sulfanyl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | Cc1nc(-c2nnc(SCCCCCC3(C(=O)NCC(F)(F)F)c4ccccc4-c4ccccc43)n2-c2cccc(F)c2)cs1 |
| InChI | InChI=1S/C33H29F4N5OS2/c1-21-39-28(19-45-21)29-40-41-31(42(29)23-11-9-10-22(34)18-23)44-17-8-2-7-16-32(30(43)38-20-33(35,36)37)26-14-5-3-12-24(26)25-13-4-6-15-27(25)32/h3-6,9-15,18-19H,2,7-8,16-17,20H2,1H3,(H,38,43) |
| InChIKey | CVSUMBFHMQSDAS-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|