C36H34N2O2S2 — CID 22891493
N-[2-(4-methoxyphenyl)ethyl]-9-[4-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]butyl]fluorene-9-carboxamide (PubChem CID 22891493) has the molecular formula C36H34N2O2S2 and a molecular weight of 590.81 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-9-[4-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]butyl]fluorene-9-carboxamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-9-[4-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]butyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891493 |
| Molecular Formula | C36H34N2O2S2 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-9-[4-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]butyl]fluorene-9-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2(CCCCSc3nc(-c4ccccc4)cs3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C36H34N2O2S2/c1-40-28-19-17-26(18-20-28)21-23-37-34(39)36(31-15-7-5-13-29(31)30-14-6-8-16-32(30)36)22-9-10-24-41-35-38-33(25-42-35)27-11-3-2-4-12-27/h2-8,11-20,25H,9-10,21-24H2,1H3,(H,37,39) |
| InChIKey | UOZJUJKMJFAHMX-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|