C31H34F3N3O3 — CID 147344494
9-[5-[3-[[hydroxy(phenyl)methyl]amino]propanoylamino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 147344494) has the molecular formula C31H34F3N3O3 and a molecular weight of 553.63 g/mol. Its IUPAC name is 9-[5-[3-[[hydroxy(phenyl)methyl]amino]propanoylamino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[5-[3-[[hydroxy(phenyl)methyl]amino]propanoylamino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 147344494 |
| Molecular Formula | C31H34F3N3O3 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 9-[5-[3-[[hydroxy(phenyl)methyl]amino]propanoylamino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(CCNC(O)c1ccccc1)NCCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H34F3N3O3/c32-31(33,34)21-37-29(40)30(25-15-7-5-13-23(25)24-14-6-8-16-26(24)30)18-9-2-10-19-35-27(38)17-20-36-28(39)22-11-3-1-4-12-22/h1,3-8,11-16,28,36,39H,2,9-10,17-21H2,(H,35,38)(H,37,40) |
| InChIKey | DEDUBBCSKUTEKK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|