C40H33F3N4O2 — CID 18409293
9-[4-[4-[(2-pyridin-2-ylbenzoyl)amino]indol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18409293) has the molecular formula C40H33F3N4O2 and a molecular weight of 658.72 g/mol. Its IUPAC name is 9-[4-[4-[(2-pyridin-2-ylbenzoyl)amino]indol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[(2-pyridin-2-ylbenzoyl)amino]indol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18409293 |
| Molecular Formula | C40H33F3N4O2 |
| Molecular Weight | 658.72 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | 9-[4-[4-[(2-pyridin-2-ylbenzoyl)amino]indol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(Nc1cccc2c1ccn2CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)c1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C40H33F3N4O2/c41-40(42,43)26-45-38(49)39(32-16-5-3-12-27(32)28-13-4-6-17-33(28)39)22-8-10-24-47-25-21-31-35(19-11-20-36(31)47)46-37(48)30-15-2-1-14-29(30)34-18-7-9-23-44-34/h1-7,9,11-21,23,25H,8,10,22,24,26H2,(H,45,49)(H,46,48) |
| InChIKey | XWHWOZHTHGHYRQ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.72 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|