C31H30ClF3N4OS — CID 22636367
9-[4-[4-(5-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22636367) has the molecular formula C31H30ClF3N4OS and a molecular weight of 599.12 g/mol. Its IUPAC name is 9-[4-[4-(5-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-(5-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22636367 |
| Molecular Formula | C31H30ClF3N4OS |
| Molecular Weight | 599.12 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 9-[4-[4-(5-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCN2CCN(c3nc4cc(Cl)ccc4s3)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H30ClF3N4OS/c32-21-11-12-27-26(19-21)37-29(41-27)39-17-15-38(16-18-39)14-6-5-13-30(28(40)36-20-31(33,34)35)24-9-3-1-7-22(24)23-8-2-4-10-25(23)30/h1-4,7-12,19H,5-6,13-18,20H2,(H,36,40) |
| InChIKey | JKKXWKYXOGAOHL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.12 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|