C31H31F3N4O2S — CID 91326706
[9-[4-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 91326706) has the molecular formula C31H31F3N4O2S and a molecular weight of 580.68 g/mol. Its IUPAC name is [9-[4-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [9-[4-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 91326706 |
| Molecular Formula | C31H31F3N4O2S |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | [9-[4-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(NCC(F)(F)F)OC1(CCCCN2CCN(c3nc4ccccc4s3)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H31F3N4O2S/c32-31(33,34)21-35-29(39)40-30(24-11-3-1-9-22(24)23-10-2-4-12-25(23)30)15-7-8-16-37-17-19-38(20-18-37)28-36-26-13-5-6-14-27(26)41-28/h1-6,9-14H,7-8,15-21H2,(H,35,39) |
| InChIKey | JFWLDQKDBVBGGG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|