C32H33F3N4O3 — CID 70139957
[9-[4-[4-(4-methyl-1,3-benzoxazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 70139957) has the molecular formula C32H33F3N4O3 and a molecular weight of 578.64 g/mol. Its IUPAC name is [9-[4-[4-(4-methyl-1,3-benzoxazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [9-[4-[4-(4-methyl-1,3-benzoxazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 70139957 |
| Molecular Formula | C32H33F3N4O3 |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | [9-[4-[4-(4-methyl-1,3-benzoxazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | Cc1cccc2oc(N3CCN(CCCCC4(OC(=O)NCC(F)(F)F)c5ccccc5-c5ccccc54)CC3)nc12 |
| InChI | InChI=1S/C32H33F3N4O3/c1-22-9-8-14-27-28(22)37-29(41-27)39-19-17-38(18-20-39)16-7-6-15-31(42-30(40)36-21-32(33,34)35)25-12-4-2-10-23(25)24-11-3-5-13-26(24)31/h2-5,8-14H,6-7,15-21H2,1H3,(H,36,40) |
| InChIKey | OADSOQHBANPHJF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|