C32H35F3N4O3 — CID 70143477
[9-[4-[4-(benzylcarbamoyl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 70143477) has the molecular formula C32H35F3N4O3 and a molecular weight of 580.65 g/mol. Its IUPAC name is [9-[4-[4-(benzylcarbamoyl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [9-[4-[4-(benzylcarbamoyl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 70143477 |
| Molecular Formula | C32H35F3N4O3 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | [9-[4-[4-(benzylcarbamoyl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(NCC(F)(F)F)OC1(CCCCN2CCN(C(=O)NCc3ccccc3)CC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H35F3N4O3/c33-32(34,35)23-37-30(41)42-31(27-14-6-4-12-25(27)26-13-5-7-15-28(26)31)16-8-9-17-38-18-20-39(21-19-38)29(40)36-22-24-10-2-1-3-11-24/h1-7,10-15H,8-9,16-23H2,(H,36,40)(H,37,41) |
| InChIKey | FMOGXGVGALJGSP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|