C32H33F3N4O3S — CID 70139825
[9-[4-[4-(4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 70139825) has the molecular formula C32H33F3N4O3S and a molecular weight of 610.70 g/mol. Its IUPAC name is [9-[4-[4-(4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [9-[4-[4-(4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 70139825 |
| Molecular Formula | C32H33F3N4O3S |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | [9-[4-[4-(4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]butyl]fluoren-9-yl] N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | COc1cccc2sc(N3CCN(CCCCC4(OC(=O)NCC(F)(F)F)c5ccccc5-c5ccccc54)CC3)nc12 |
| InChI | InChI=1S/C32H33F3N4O3S/c1-41-26-13-8-14-27-28(26)37-29(43-27)39-19-17-38(18-20-39)16-7-6-15-31(42-30(40)36-21-32(33,34)35)24-11-4-2-9-22(24)23-10-3-5-12-25(23)31/h2-5,8-14H,6-7,15-21H2,1H3,(H,36,40) |
| InChIKey | IOXGJVOXKREKQD-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|