C31H31F3N4O3 — CID 22636281
9-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)xanthene-9-carboxamide (PubChem CID 22636281) has the molecular formula C31H31F3N4O3 and a molecular weight of 564.61 g/mol. Its IUPAC name is 9-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)xanthene-9-carboxamide.
| Compound Name | 9-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)xanthene-9-carboxamide |
|---|---|
| PubChem CID | 22636281 |
| Molecular Formula | C31H31F3N4O3 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 9-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)xanthene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCN2CCN(c3nc4ccccc4o3)CC2)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C31H31F3N4O3/c32-31(33,34)21-35-28(39)30(22-9-1-4-12-25(22)40-26-13-5-2-10-23(26)30)15-7-8-16-37-17-19-38(20-18-37)29-36-24-11-3-6-14-27(24)41-29/h1-6,9-14H,7-8,15-21H2,(H,35,39) |
| InChIKey | CSWDIDFLJCLNSM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|