C34H35F3N4O2 — CID 22636324
9-[4-[4-(6-methylquinolin-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)xanthene-9-carboxamide (PubChem CID 22636324) has the molecular formula C34H35F3N4O2 and a molecular weight of 588.67 g/mol. Its IUPAC name is 9-[4-[4-(6-methylquinolin-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)xanthene-9-carboxamide.
| Compound Name | 9-[4-[4-(6-methylquinolin-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)xanthene-9-carboxamide |
|---|---|
| PubChem CID | 22636324 |
| Molecular Formula | C34H35F3N4O2 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 9-[4-[4-(6-methylquinolin-2-yl)piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)xanthene-9-carboxamide |
| SMILES | Cc1ccc2nc(N3CCN(CCCCC4(C(=O)NCC(F)(F)F)c5ccccc5Oc5ccccc54)CC3)ccc2c1 |
| InChI | InChI=1S/C34H35F3N4O2/c1-24-12-14-28-25(22-24)13-15-31(39-28)41-20-18-40(19-21-41)17-7-6-16-33(32(42)38-23-34(35,36)37)26-8-2-4-10-29(26)43-30-11-5-3-9-27(30)33/h2-5,8-15,22H,6-7,16-21,23H2,1H3,(H,38,42) |
| InChIKey | CQBOCVIAHBFGAH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|