C35H38F3N3O3 — CID 22891317
9-[5-[(3-benzamidocyclohexanecarbonyl)amino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22891317) has the molecular formula C35H38F3N3O3 and a molecular weight of 605.70 g/mol. Its IUPAC name is 9-[5-[(3-benzamidocyclohexanecarbonyl)amino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[5-[(3-benzamidocyclohexanecarbonyl)amino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891317 |
| Molecular Formula | C35H38F3N3O3 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | 9-[5-[(3-benzamidocyclohexanecarbonyl)amino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NC1CCCC(C(=O)NCCCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)C1)c1ccccc1 |
| InChI | InChI=1S/C35H38F3N3O3/c36-35(37,38)23-40-33(44)34(29-18-7-5-16-27(29)28-17-6-8-19-30(28)34)20-9-2-10-21-39-31(42)25-14-11-15-26(22-25)41-32(43)24-12-3-1-4-13-24/h1,3-8,12-13,16-19,25-26H,2,9-11,14-15,20-23H2,(H,39,42)(H,40,44)(H,41,43) |
| InChIKey | MYQGURZBGZPBIC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|