C38H37F3N2O3S — CID 59916717
9-[4-[(5R)-5-[[2-(4-methylphenyl)benzoyl]amino]-1,3-oxathian-2-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 59916717) has the molecular formula C38H37F3N2O3S and a molecular weight of 658.79 g/mol. Its IUPAC name is 9-[4-[(5R)-5-[[2-(4-methylphenyl)benzoyl]amino]-1,3-oxathian-2-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[(5R)-5-[[2-(4-methylphenyl)benzoyl]amino]-1,3-oxathian-2-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 59916717 |
| Molecular Formula | C38H37F3N2O3S |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | 9-[4-[(5R)-5-[[2-(4-methylphenyl)benzoyl]amino]-1,3-oxathian-2-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | Cc1ccc(-c2ccccc2C(=O)N[C@@H]2COC(CCCCC3(C(=O)NCC(F)(F)F)c4ccccc4-c4ccccc43)SC2)cc1 |
| InChI | InChI=1S/C38H37F3N2O3S/c1-25-17-19-26(20-18-25)28-10-2-3-13-31(28)35(44)43-27-22-46-34(47-23-27)16-8-9-21-37(36(45)42-24-38(39,40)41)32-14-6-4-11-29(32)30-12-5-7-15-33(30)37/h2-7,10-15,17-20,27,34H,8-9,16,21-24H2,1H3,(H,42,45)(H,43,44)/t27-,34?/m1/s1 |
| InChIKey | VLHJCSUAXKOHQY-RVLHTLCESA-N |
| XLogP | 8.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|