C40H46ClF3N4O2 — CID 22180418
9-[4-[4-[3-chloro-4-[cyclohexyl(prop-2-enyl)carbamoyl]phenyl]piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22180418) has the molecular formula C40H46ClF3N4O2 and a molecular weight of 707.28 g/mol. Its IUPAC name is 9-[4-[4-[3-chloro-4-[cyclohexyl(prop-2-enyl)carbamoyl]phenyl]piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[3-chloro-4-[cyclohexyl(prop-2-enyl)carbamoyl]phenyl]piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22180418 |
| Molecular Formula | C40H46ClF3N4O2 |
| Molecular Weight | 707.28 g/mol |
| Exact Mass | 706.33 |
| IUPAC Name | 9-[4-[4-[3-chloro-4-[cyclohexyl(prop-2-enyl)carbamoyl]phenyl]piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | C=CCN(C(=O)c1ccc(N2CCN(CCCCC3(C(=O)NCC(F)(F)F)c4ccccc4-c4ccccc43)CC2)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C40H46ClF3N4O2/c1-2-21-48(29-12-4-3-5-13-29)37(49)33-19-18-30(27-36(33)41)47-25-23-46(24-26-47)22-11-10-20-39(38(50)45-28-40(42,43)44)34-16-8-6-14-31(34)32-15-7-9-17-35(32)39/h2,6-9,14-19,27,29H,1,3-5,10-13,20-26,28H2,(H,45,50) |
| InChIKey | LZUONEVVMQCJMP-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.28 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|