C36H41F3N4O3 — CID 10189527
1-benzyl-N-[3-oxo-3-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butylamino]propyl]piperidine-2-carboxamide (PubChem CID 10189527) has the molecular formula C36H41F3N4O3 and a molecular weight of 634.74 g/mol. Its IUPAC name is 1-benzyl-N-[3-oxo-3-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butylamino]propyl]piperidine-2-carboxamide.
| Compound Name | 1-benzyl-N-[3-oxo-3-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butylamino]propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 10189527 |
| Molecular Formula | C36H41F3N4O3 |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | 1-benzyl-N-[3-oxo-3-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butylamino]propyl]piperidine-2-carboxamide |
| SMILES | O=C(CCNC(=O)C1CCCCN1Cc1ccccc1)NCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C36H41F3N4O3/c37-36(38,39)25-42-34(46)35(29-16-6-4-14-27(29)28-15-5-7-17-30(28)35)20-9-10-21-40-32(44)19-22-41-33(45)31-18-8-11-23-43(31)24-26-12-2-1-3-13-26/h1-7,12-17,31H,8-11,18-25H2,(H,40,44)(H,41,45)(H,42,46) |
| InChIKey | NNLVIYWHJAPXPB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|