C41H34F6N4O2 — CID 162547831
9-[4-[2-[3-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]aziridin-2-yl]pyrimidin-5-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 162547831) has the molecular formula C41H34F6N4O2 and a molecular weight of 728.74 g/mol. Its IUPAC name is 9-[4-[2-[3-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]aziridin-2-yl]pyrimidin-5-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[2-[3-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]aziridin-2-yl]pyrimidin-5-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 162547831 |
| Molecular Formula | C41H34F6N4O2 |
| Molecular Weight | 728.74 g/mol |
| Exact Mass | 728.26 |
| IUPAC Name | 9-[4-[2-[3-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]aziridin-2-yl]pyrimidin-5-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(CC1NC1c1ncc(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)cn1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C41H34F6N4O2/c42-40(43,44)24-50-38(53)39(32-14-5-3-11-29(32)30-12-4-6-15-33(30)39)20-8-7-9-25-22-48-37(49-23-25)36-34(51-36)21-35(52)31-13-2-1-10-28(31)26-16-18-27(19-17-26)41(45,46)47/h1-6,10-19,22-23,34,36,51H,7-9,20-21,24H2,(H,50,53) |
| InChIKey | GTSYYDRDEZDDIM-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.74 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|