C38H36F6N3O2+ — CID 162547700
9-[4-[1-methyl-3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pyrrolidin-1-ium-1-yl]butyl]-N-(trifluoromethyl)fluorene-9-carboxamide (PubChem CID 162547700) has the molecular formula C38H36F6N3O2+ and a molecular weight of 680.71 g/mol. Its IUPAC name is 9-[4-[1-methyl-3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pyrrolidin-1-ium-1-yl]butyl]-N-(trifluoromethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[1-methyl-3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pyrrolidin-1-ium-1-yl]butyl]-N-(trifluoromethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 162547700 |
| Molecular Formula | C38H36F6N3O2+ |
| Molecular Weight | 680.71 g/mol |
| Exact Mass | 680.27 |
| IUPAC Name | 9-[4-[1-methyl-3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pyrrolidin-1-ium-1-yl]butyl]-N-(trifluoromethyl)fluorene-9-carboxamide |
| SMILES | C[N+]1(CCCCC2(C(=O)NC(F)(F)F)c3ccccc3-c3ccccc32)CCC(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C38H35F6N3O2/c1-47(23-20-27(24-47)45-34(48)31-13-3-2-10-28(31)25-16-18-26(19-17-25)37(39,40)41)22-9-8-21-36(35(49)46-38(42,43)44)32-14-6-4-11-29(32)30-12-5-7-15-33(30)36/h2-7,10-19,27H,8-9,20-24H2,1H3,(H-,45,46,48,49)/p+1 |
| InChIKey | YQSBODRIOJULTH-UHFFFAOYSA-O |
| XLogP | 8.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.71 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|