C38H44F3N3O2 — CID 142276863
(Z)-but-2-ene;3-methyl-1-[4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]indene-1-carboxamide (PubChem CID 142276863) has the molecular formula C38H44F3N3O2 and a molecular weight of 631.78 g/mol. Its IUPAC name is (Z)-but-2-ene;3-methyl-1-[4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]indene-1-carboxamide.
| Compound Name | (Z)-but-2-ene;3-methyl-1-[4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]indene-1-carboxamide |
|---|---|
| PubChem CID | 142276863 |
| Molecular Formula | C38H44F3N3O2 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | (Z)-but-2-ene;3-methyl-1-[4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]indene-1-carboxamide |
| SMILES | C/C=C\C.CC1=CC(CCCCN2CCC(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)CC2)(C(N)=O)c2ccccc21 |
| InChI | InChI=1S/C34H36F3N3O2.C4H8/c1-23-22-33(32(38)42,30-11-5-4-8-27(23)30)18-6-7-19-40-20-16-26(17-21-40)39-31(41)29-10-3-2-9-28(29)24-12-14-25(15-13-24)34(35,36)37;1-3-4-2/h2-5,8-15,22,26H,6-7,16-21H2,1H3,(H2,38,42)(H,39,41);3-4H,1-2H3/b;4-3- |
| InChIKey | CUKXXBFPVGSKRD-QGAMPUOQSA-N |
| XLogP | 8.16 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|