C32H34Cl2F3N3O3 — CID 162621753
9-[4-[4-[2-(3,4-dichlorophenyl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethanamine (PubChem CID 162621753) has the molecular formula C32H34Cl2F3N3O3 and a molecular weight of 636.54 g/mol. Its IUPAC name is 9-[4-[4-[2-(3,4-dichlorophenyl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethanamine.
| Compound Name | 9-[4-[4-[2-(3,4-dichlorophenyl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 162621753 |
| Molecular Formula | C32H34Cl2F3N3O3 |
| Molecular Weight | 636.54 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | 9-[4-[4-[2-(3,4-dichlorophenyl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethanamine |
| SMILES | NCC(F)(F)F.O=C(Cc1ccc(Cl)c(Cl)c1)N1CCN(CCCCC2(C(=O)O)c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C30H30Cl2N2O3.C2H4F3N/c31-26-12-11-21(19-27(26)32)20-28(35)34-17-15-33(16-18-34)14-6-5-13-30(29(36)37)24-9-3-1-7-22(24)23-8-2-4-10-25(23)30;3-2(4,5)1-6/h1-4,7-12,19H,5-6,13-18,20H2,(H,36,37);1,6H2 |
| InChIKey | PNLUELDEFDFTKQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|