C39H39F3N3O3- — CID 159911324
9-[4-[4-[2-(9H-fluoren-4-yl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethylazanide (PubChem CID 159911324) has the molecular formula C39H39F3N3O3- and a molecular weight of 654.75 g/mol. Its IUPAC name is 9-[4-[4-[2-(9H-fluoren-4-yl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethylazanide.
| Compound Name | 9-[4-[4-[2-(9H-fluoren-4-yl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethylazanide |
|---|---|
| PubChem CID | 159911324 |
| Molecular Formula | C39H39F3N3O3- |
| Molecular Weight | 654.75 g/mol |
| Exact Mass | 654.29 |
| IUPAC Name | 9-[4-[4-[2-(9H-fluoren-4-yl)acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethylazanide |
| SMILES | O=C(Cc1cccc2c1-c1ccccc1C2)N1CCN(CCCCC2(C(=O)O)c3ccccc3-c3ccccc32)CC1.[NH-]CC(F)(F)F |
| InChI | InChI=1S/C37H36N2O3.C2H3F3N/c40-34(25-28-12-9-11-27-24-26-10-1-2-13-29(26)35(27)28)39-22-20-38(21-23-39)19-8-7-18-37(36(41)42)32-16-5-3-14-30(32)31-15-4-6-17-33(31)37;3-2(4,5)1-6/h1-6,9-17H,7-8,18-25H2,(H,41,42);6H,1H2/q;-1 |
| InChIKey | NXFGIBJOPNNLBS-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.75 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|