C34H40F3N3O4 — CID 171932095
9-[4-[4-[2-[4-(methoxymethyl)phenyl]acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethanamine (PubChem CID 171932095) has the molecular formula C34H40F3N3O4 and a molecular weight of 611.71 g/mol. Its IUPAC name is 9-[4-[4-[2-[4-(methoxymethyl)phenyl]acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethanamine.
| Compound Name | 9-[4-[4-[2-[4-(methoxymethyl)phenyl]acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 171932095 |
| Molecular Formula | C34H40F3N3O4 |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | 9-[4-[4-[2-[4-(methoxymethyl)phenyl]acetyl]piperazin-1-yl]butyl]fluorene-9-carboxylic acid;2,2,2-trifluoroethanamine |
| SMILES | COCc1ccc(CC(=O)N2CCN(CCCCC3(C(=O)O)c4ccccc4-c4ccccc43)CC2)cc1.NCC(F)(F)F |
| InChI | InChI=1S/C32H36N2O4.C2H4F3N/c1-38-23-25-14-12-24(13-15-25)22-30(35)34-20-18-33(19-21-34)17-7-6-16-32(31(36)37)28-10-4-2-8-26(28)27-9-3-5-11-29(27)32;3-2(4,5)1-6/h2-5,8-15H,6-7,16-23H2,1H3,(H,36,37);1,6H2 |
| InChIKey | OYGBTVOOTXXHHF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|