C21H30N4O — CID 72842623
1-[4-(3-phenylpropyl)-1,4-diazepan-1-yl]-2-pyrazol-1-ylbutan-1-one (PubChem CID 72842623) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-[4-(3-phenylpropyl)-1,4-diazepan-1-yl]-2-pyrazol-1-ylbutan-1-one.
| Compound Name | 1-[4-(3-phenylpropyl)-1,4-diazepan-1-yl]-2-pyrazol-1-ylbutan-1-one |
|---|---|
| PubChem CID | 72842623 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-[4-(3-phenylpropyl)-1,4-diazepan-1-yl]-2-pyrazol-1-ylbutan-1-one |
| SMILES | CCC(C(=O)N1CCCN(CCCc2ccccc2)CC1)n1cccn1 |
| InChI | InChI=1S/C21H30N4O/c1-2-20(25-16-7-12-22-25)21(26)24-15-8-14-23(17-18-24)13-6-11-19-9-4-3-5-10-19/h3-5,7,9-10,12,16,20H,2,6,8,11,13-15,17-18H2,1H3 |
| InChIKey | CTULAMJAKBZWOX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |