C14H14F3IN2O2 — CID 108543646
2,2,2-trifluoro-1-[4-(2-iodobenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 108543646) has the molecular formula C14H14F3IN2O2 and a molecular weight of 426.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-(2-iodobenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-(2-iodobenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 108543646 |
| Molecular Formula | C14H14F3IN2O2 |
| Molecular Weight | 426.18 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-(2-iodobenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | O=C(c1ccccc1I)N1CCCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H14F3IN2O2/c15-14(16,17)13(22)20-7-3-6-19(8-9-20)12(21)10-4-1-2-5-11(10)18/h1-2,4-5H,3,6-9H2 |
| InChIKey | GVKWAWHHSWUAAM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|