C14H14F3IN2O2 — CID 108548674
2,2,2-trifluoro-N-[1-(2-iodobenzoyl)piperidin-4-yl]acetamide (PubChem CID 108548674) has the molecular formula C14H14F3IN2O2 and a molecular weight of 426.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-(2-iodobenzoyl)piperidin-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-(2-iodobenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108548674 |
| Molecular Formula | C14H14F3IN2O2 |
| Molecular Weight | 426.18 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-(2-iodobenzoyl)piperidin-4-yl]acetamide |
| SMILES | O=C(c1ccccc1I)N1CCC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H14F3IN2O2/c15-14(16,17)13(22)19-9-5-7-20(8-6-9)12(21)10-3-1-2-4-11(10)18/h1-4,9H,5-8H2,(H,19,22) |
| InChIKey | FDXIFDSGRXJTGN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|