C15H16F3IN2O2 — CID 108932663
2,2,2-trifluoro-N-[[1-(2-iodobenzoyl)piperidin-4-yl]methyl]acetamide (PubChem CID 108932663) has the molecular formula C15H16F3IN2O2 and a molecular weight of 440.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[1-(2-iodobenzoyl)piperidin-4-yl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[1-(2-iodobenzoyl)piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 108932663 |
| Molecular Formula | C15H16F3IN2O2 |
| Molecular Weight | 440.20 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 2,2,2-trifluoro-N-[[1-(2-iodobenzoyl)piperidin-4-yl]methyl]acetamide |
| SMILES | O=C(c1ccccc1I)N1CCC(CNC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H16F3IN2O2/c16-15(17,18)14(23)20-9-10-5-7-21(8-6-10)13(22)11-3-1-2-4-12(11)19/h1-4,10H,5-9H2,(H,20,23) |
| InChIKey | MZNZXTFFLLHELC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|