C17H25IN2O — CID 61245242
(2-iodophenyl)-[4-[[methyl(propan-2-yl)amino]methyl]piperidin-1-yl]methanone (PubChem CID 61245242) has the molecular formula C17H25IN2O and a molecular weight of 400.30 g/mol. Its IUPAC name is (2-iodophenyl)-[4-[[methyl(propan-2-yl)amino]methyl]piperidin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[4-[[methyl(propan-2-yl)amino]methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 61245242 |
| Molecular Formula | C17H25IN2O |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (2-iodophenyl)-[4-[[methyl(propan-2-yl)amino]methyl]piperidin-1-yl]methanone |
| SMILES | CC(C)N(C)CC1CCN(C(=O)c2ccccc2I)CC1 |
| InChI | InChI=1S/C17H25IN2O/c1-13(2)19(3)12-14-8-10-20(11-9-14)17(21)15-6-4-5-7-16(15)18/h4-7,13-14H,8-12H2,1-3H3 |
| InChIKey | JOBQYZXXHSBDRN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|