C16H20ClIN2O2 — CID 108563967
4-chloro-N-[1-(2-iodobenzoyl)piperidin-4-yl]butanamide (PubChem CID 108563967) has the molecular formula C16H20ClIN2O2 and a molecular weight of 434.71 g/mol. Its IUPAC name is 4-chloro-N-[1-(2-iodobenzoyl)piperidin-4-yl]butanamide.
| Compound Name | 4-chloro-N-[1-(2-iodobenzoyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 108563967 |
| Molecular Formula | C16H20ClIN2O2 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 4-chloro-N-[1-(2-iodobenzoyl)piperidin-4-yl]butanamide |
| SMILES | O=C(CCCCl)NC1CCN(C(=O)c2ccccc2I)CC1 |
| InChI | InChI=1S/C16H20ClIN2O2/c17-9-3-6-15(21)19-12-7-10-20(11-8-12)16(22)13-4-1-2-5-14(13)18/h1-2,4-5,12H,3,6-11H2,(H,19,21) |
| InChIKey | GVFJMNWHCFHMSR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|