C16H21IN2O — CID 60735523
(4-cyclopentylpiperazin-1-yl)-(2-iodophenyl)methanone (PubChem CID 60735523) has the molecular formula C16H21IN2O and a molecular weight of 384.26 g/mol. Its IUPAC name is (4-cyclopentylpiperazin-1-yl)-(2-iodophenyl)methanone.
| Compound Name | (4-cyclopentylpiperazin-1-yl)-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 60735523 |
| Molecular Formula | C16H21IN2O |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | (4-cyclopentylpiperazin-1-yl)-(2-iodophenyl)methanone |
| SMILES | O=C(c1ccccc1I)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C16H21IN2O/c17-15-8-4-3-7-14(15)16(20)19-11-9-18(10-12-19)13-5-1-2-6-13/h3-4,7-8,13H,1-2,5-6,9-12H2 |
| InChIKey | VUUHIDOFBFQSEO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|